Last active
December 22, 2022 14:06
-
-
Save jskherman/48843500a35609c938a7676ce41b0989 to your computer and use it in GitHub Desktop.
DWSIM Essential Oil Compound Data (JSON)
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.43, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "99-83-2", | |
| "Chao_Seader_Acentricity": 0.43, | |
| "Chao_Seader_Liquid_Molar_Volume": 189.75, | |
| "Chao_Seader_Solubility_Parameter": 6.62, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.27, | |
| "Critical_Pressure": 2746902.593, | |
| "Critical_Temperature": 657.5800633, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 12.023, | |
| "Formula": "C10H16", | |
| "HVap_A": 280.91261139429446, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 77153, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -5943715.9553147, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 124018.350074228, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -69.7388803377136, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.0136775133262853, | |
| "Ideal_Gas_Heat_Capacity_Const_E": -9.03305923137128E-12, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -709.0740931, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 775.283703, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 12338.7424309578, | |
| "Liquid_Viscosity_Const_B": 1171.34724038257, | |
| "Liquid_Viscosity_Const_C": -1.0960842869916E-05, | |
| "Liquid_Viscosity_Const_D": -12349.7409558428, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "101", | |
| "Molar_Weight": 136.23, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "alpha-Phellandrene", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 450.61, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "CC1=CCC(C(C)C)C=C1", | |
| "Solid_Density_Const_A": 7.77746852887807, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 208.88, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 208.88, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 208.88, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 69.098937848879, | |
| "Vapor_Pressure_Constant_B": -6056.99236341041, | |
| "Vapor_Pressure_Constant_C": -2.93509460419366, | |
| "Vapor_Pressure_Constant_D": -26.3806143944371, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "101", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.27, | |
| "Elements": { | |
| "C": 10, | |
| "H": 16 | |
| }, | |
| "MODFACGroups": { | |
| "1": "3", | |
| "3": "1", | |
| "6": "1", | |
| "78": "1", | |
| "79": "1", | |
| "8": "1" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "3", | |
| "2": "1", | |
| "3": "2", | |
| "6": "1", | |
| "8": "1" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.76, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "15764-04-2", | |
| "Chao_Seader_Acentricity": 0.0, | |
| "Chao_Seader_Liquid_Molar_Volume": 0.0, | |
| "Chao_Seader_Solubility_Parameter": 0.0, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.23, | |
| "Critical_Pressure": 2137.40569, | |
| "Critical_Temperature": 891.6739406, | |
| "Critical_Volume": 0.733, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 15.534, | |
| "Formula": "C15H22O", | |
| "HVap_A": -3.1912261102579054, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 88843, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -111787.080996174, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 1622.74295389509, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -1.22660876508736, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000413286799342327, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 1.39522405022868E-12, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1107.84090107569, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 355.784195450469, | |
| "InChI": "InChI=1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11H,5-7,9H2,1-4H3/t11-,15-/m0/s1", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 218.33, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "alpha-Vetivone", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 651.88, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "CC(C)=C1CCC2=CC(=O)CC(C)C2(C)C1", | |
| "Solid_Density_Const_A": 0.0, | |
| "Solid_Density_Const_B": 0.0, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 382.41, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 382.41, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "0", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 382.41, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0, | |
| "Vapor_Pressure_Constant_B": 0.0, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "0", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.0, | |
| "Elements": {}, | |
| "MODFACGroups": { | |
| "1": "4", | |
| "19": "1", | |
| "70": "1", | |
| "78": "3", | |
| "79": "1", | |
| "8": "1", | |
| "80": "1" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": {}, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.5, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "", | |
| "Chao_Seader_Acentricity": 0.0, | |
| "Chao_Seader_Liquid_Molar_Volume": 0.0, | |
| "Chao_Seader_Solubility_Parameter": 0.0, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.0, | |
| "Critical_Pressure": 10000000000.0, | |
| "Critical_Temperature": 9000.0, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 0.0, | |
| "Formula": "X", | |
| "HVap_A": 0.0, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 1942405272, | |
| "Ideal_Gas_Heat_Capacity_Const_A": 0.0, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 0.0, | |
| "Ideal_Gas_Heat_Capacity_Const_C": 0.0, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.0, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 0.0, | |
| "IdealgasCpEquation": "", | |
| "IG_Enthalpy_of_Formation_25C": -1440.764, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": -23.8548, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "", | |
| "LiquidHeatCapacityEquation": "", | |
| "LiquidThermalConductivityEquation": "", | |
| "LiquidViscosityEquation": "", | |
| "Molar_Weight": 226.64, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "BIOMASS", | |
| "NBP": 7000.0, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 7000.0, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "", | |
| "Solid_Density_Const_A": 0.0, | |
| "Solid_Density_Const_B": 0.0, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 0.0, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 948261.75999999989, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 0.0, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 1050.0, | |
| "SolidDensityEquation": "", | |
| "SolidHeatCapacityEquation": "1", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 5000.0, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0001, | |
| "Vapor_Pressure_Constant_B": 1E-07, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "2", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.0, | |
| "Elements": { | |
| "X": 1.0 | |
| }, | |
| "MODFACGroups": {}, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": {}, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": true | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.57, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "106-23-0", | |
| "Chao_Seader_Acentricity": 0.57, | |
| "Chao_Seader_Liquid_Molar_Volume": 205.94, | |
| "Chao_Seader_Solubility_Parameter": 6.9, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "E:\\OneDrive\\Documents\\scaffold\\Project Scire - Grp 3 Team Super Hot\\Simulation\\Supercritical Fluid Extraction\\Citronellal.dwcsd2", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.26, | |
| "Critical_Pressure": 2405279.492, | |
| "Critical_Temperature": 663.6, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 19.31, | |
| "Formula": "C10H18O", | |
| "HVap_A": 292.43487725258996, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 85707, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -10356.9993449018, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 954.159996718422, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -0.602499994333019, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000154399996838998, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 8.24621522532942E-19, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1511.578983, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 19.64352512, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 154.2493, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Citronellal", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 481.0, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "CC(C)=CCCC(C)CC=O", | |
| "Solid_Density_Const_A": 7.37196308974879, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 210.42, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 210.42, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 210.42, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 14.9679, | |
| "Vapor_Pressure_Constant_B": -4205.73, | |
| "Vapor_Pressure_Constant_C": -74.632, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "Exp(A + B/(T+C))*1000", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.26, | |
| "Elements": { | |
| "C": 10, | |
| "H": 18, | |
| "O": 1 | |
| }, | |
| "MODFACGroups": { | |
| "1": "3", | |
| "2": "3", | |
| "20": "1", | |
| "3": "1", | |
| "8": "1" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "3", | |
| "2": "3", | |
| "21": "1", | |
| "3": "1", | |
| "8": "1" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.7, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "487-11-6", | |
| "Chao_Seader_Acentricity": 0.7, | |
| "Chao_Seader_Liquid_Molar_Volume": 239.72, | |
| "Chao_Seader_Solubility_Parameter": 7.22, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.22, | |
| "Critical_Pressure": 2282766.777, | |
| "Critical_Temperature": 780.79, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 21.994, | |
| "Formula": "C12H16O3", | |
| "HVap_A": 274.47652216945175, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 78042, | |
| "Ideal_Gas_Heat_Capacity_Const_A": 74480.3231637865, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 676.84469922725, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -0.148969496909767, | |
| "Ideal_Gas_Heat_Capacity_Const_D": -6.4606611679569E-05, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 2.81445639435415E-12, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1729.237814, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": -448.8757937, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": -5.62993021748606, | |
| "Liquid_Viscosity_Const_B": 1621.09378899616, | |
| "Liquid_Viscosity_Const_C": -3.4809383655896E-05, | |
| "Liquid_Viscosity_Const_D": -6.28404724440153, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "101", | |
| "Molar_Weight": 208.25, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Elemicin", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 579.52, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "C=CCc1cc(OC)c(OC)c(OC)c1", | |
| "Solid_Density_Const_A": 8.27521029581472, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 353.91, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 353.91, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 353.91, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0, | |
| "Vapor_Pressure_Constant_B": 0.0, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "0", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.22, | |
| "Elements": { | |
| "C": 12, | |
| "H": 16, | |
| "O": 3 | |
| }, | |
| "MODFACGroups": { | |
| "10": "3", | |
| "12": "1", | |
| "24": "3", | |
| "5": "1", | |
| "9": "2" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "10": "2", | |
| "11": "3", | |
| "13": "1", | |
| "25": "3", | |
| "5": "1" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.93, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "639-99-6", | |
| "Chao_Seader_Acentricity": 0.93, | |
| "Chao_Seader_Liquid_Molar_Volume": 272.37, | |
| "Chao_Seader_Solubility_Parameter": 7.21, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.22, | |
| "Critical_Pressure": 1933833.5, | |
| "Critical_Temperature": 836.4518346, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 15.089, | |
| "Formula": "C15H26O", | |
| "HVap_A": 282.0893036877132, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 88942, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -139322.63106101, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 1909.61343468052, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -1.54532900567006, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000536811822942788, | |
| "Ideal_Gas_Heat_Capacity_Const_E": -9.48047808313527E-13, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1097.10869, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 504.1681226, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 222.37, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Elemol", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 635.24, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "C=CC1(C)CCC(C(C)(C)O)CC1C(=C)C", | |
| "Solid_Density_Const_A": 6.853883404221, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 327.37, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 327.37, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 327.37, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0, | |
| "Vapor_Pressure_Constant_B": 0.0, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "0", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.22, | |
| "Elements": { | |
| "C": 15, | |
| "H": 26, | |
| "O": 1 | |
| }, | |
| "MODFACGroups": { | |
| "1": "4", | |
| "4": "1", | |
| "5": "1", | |
| "7": "1", | |
| "78": "3", | |
| "79": "2", | |
| "80": "1", | |
| "82": "1" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "4", | |
| "15": "1", | |
| "2": "3", | |
| "3": "2", | |
| "4": "2", | |
| "5": "1", | |
| "7": "1" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": -2.73, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "106-24-1", | |
| "Chao_Seader_Acentricity": 0.0, | |
| "Chao_Seader_Liquid_Molar_Volume": 0.0, | |
| "Chao_Seader_Solubility_Parameter": 0.0, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "E:\\OneDrive\\Documents\\scaffold\\Project Scire - Grp 3 Team Super Hot\\Simulation\\Supercritical Fluid Extraction\\Geraniol.dwcsd2", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.0, | |
| "Critical_Pressure": 2571497.928, | |
| "Critical_Temperature": 705.46, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 23.53, | |
| "Formula": "C10H18O", | |
| "HVap_A": -3.83638360562605, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 22039, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -28657.1789537139, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 1027.66496679908, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -0.722803981725229, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000216001699402348, | |
| "Ideal_Gas_Heat_Capacity_Const_E": -2.7584062923081E-13, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1212.971469, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 258.2831818, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": -278584.546080807, | |
| "Liquid_Heat_Capacity_Const_B": 8188.47319318763, | |
| "Liquid_Heat_Capacity_Const_C": -49.0158383187817, | |
| "Liquid_Heat_Capacity_Const_D": 0.135344697134083, | |
| "Liquid_Heat_Capacity_Const_E": -0.000132708252736945, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "5", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 154.25, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Geraniol", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 503.2, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "CC(C)=CCCC(C)=CCO", | |
| "Solid_Density_Const_A": 1.12802348530211, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 225.2, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 225.2, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 225.2, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": -178.037969678771, | |
| "Vapor_Pressure_Constant_B": -14654.5371749198, | |
| "Vapor_Pressure_Constant_C": -17.573266565433, | |
| "Vapor_Pressure_Constant_D": 327.906766746736, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "101", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.0, | |
| "Elements": { | |
| "C": 10, | |
| "H": 18, | |
| "O": 1 | |
| }, | |
| "MODFACGroups": { | |
| "1": "3", | |
| "14": "1", | |
| "2": "3", | |
| "8": "2" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "3", | |
| "15": "1", | |
| "2": "3", | |
| "8": "2" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 1.12, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "16223-63-5", | |
| "Chao_Seader_Acentricity": 0.0, | |
| "Chao_Seader_Liquid_Molar_Volume": 0.0, | |
| "Chao_Seader_Solubility_Parameter": 0.0, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.25, | |
| "Critical_Pressure": 2304737.457, | |
| "Critical_Temperature": 861.5971204, | |
| "Critical_Volume": 0.728, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 17.286, | |
| "Formula": "C15H24O", | |
| "HVap_A": 316.1792415460618, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 83696, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -232238.081174034, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 2309.63276051101, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -2.25239108460835, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000925694696202749, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 1.00673506798036E-12, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1021.28200299069, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 559.6992065, | |
| "InChI": "InChI=1S/C15H24O/c1-10-13-5-4-12(9-16)15(13)7-6-11(8-15)14(10,2)3/h11-13,16H,1,4-9H2,2-3H3/t11-,12-,13?,15+/m0/s1", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 220.35, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Khusimol", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 653.84, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "C=C1C2CCC(CO)C23CCC(C3)C1(C)C", | |
| "Solid_Density_Const_A": 0.0, | |
| "Solid_Density_Const_B": 0.0, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 419.41, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 419.41, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "0", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 419.41, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0, | |
| "Vapor_Pressure_Constant_B": 0.0, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "0", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.0, | |
| "Elements": {}, | |
| "MODFACGroups": { | |
| "1": "2", | |
| "14": "1", | |
| "2": "1", | |
| "7": "1", | |
| "78": "5", | |
| "79": "3", | |
| "80": "2" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": {}, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.34, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "5989-27-5", | |
| "Chao_Seader_Acentricity": 0.34, | |
| "Chao_Seader_Liquid_Molar_Volume": 196.73, | |
| "Chao_Seader_Solubility_Parameter": 6.48, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.27, | |
| "Critical_Pressure": 2755561.067, | |
| "Critical_Temperature": 657.1555906, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 11.734, | |
| "Formula": "C10H17", | |
| "HVap_A": 281.13769701596124, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 92899, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -52408.6648687443, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 940.313928559779, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -0.546628270801474, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000115901949372024, | |
| "Ideal_Gas_Heat_Capacity_Const_E": -2.4673781876053E-12, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -245.6068236, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 1155.291631, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 136.23, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Limonene", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 450.34, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "C=C(C)C1CC=C(C)CC1", | |
| "Solid_Density_Const_A": 7.84192500931007, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 198.65, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 198.65, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 198.65, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 72.2539342857788, | |
| "Vapor_Pressure_Constant_B": -6025.13650523464, | |
| "Vapor_Pressure_Constant_C": -2.66057339608452, | |
| "Vapor_Pressure_Constant_D": -31.0760445573815, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "101", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.27, | |
| "Elements": { | |
| "C": 10, | |
| "H": 17 | |
| }, | |
| "MODFACGroups": { | |
| "1": "2", | |
| "7": "1", | |
| "78": "3", | |
| "79": "1", | |
| "8": "1" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "2", | |
| "2": "3", | |
| "3": "1", | |
| "5": "1", | |
| "8": "1" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.84, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "106-25-2", | |
| "Chao_Seader_Acentricity": 0.84, | |
| "Chao_Seader_Liquid_Molar_Volume": 176.7, | |
| "Chao_Seader_Solubility_Parameter": 8.39, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "E:\\OneDrive\\Documents\\scaffold\\Project Scire - Grp 3 Team Super Hot\\Simulation\\Supercritical Fluid Extraction\\Nerol.dwcsd2", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.25, | |
| "Critical_Pressure": 2571497.928, | |
| "Critical_Temperature": 705.46, | |
| "Critical_Volume": 0.0, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 23.53, | |
| "Formula": "C10H18O", | |
| "HVap_A": 366.05598221617839, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 53384, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -28657.1789537139, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 1027.66496679908, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -0.722803981725229, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000216001699402348, | |
| "Ideal_Gas_Heat_Capacity_Const_E": -2.7584062923081E-13, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1212.971469, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": 258.2831818, | |
| "InChI": "", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 154.25, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Nerol", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 528.46, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "CC(C)=CCCC(C)=CCO", | |
| "Solid_Density_Const_A": 7.97886591329908, | |
| "Solid_Density_Const_B": -0.005, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 225.2, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 225.2, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "2", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 225.2, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.80766706408032, | |
| "Vapor_Pressure_Constant_B": -9321.66648660998, | |
| "Vapor_Pressure_Constant_C": -5.41348345694203, | |
| "Vapor_Pressure_Constant_D": 62.9836017107045, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "101", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.25, | |
| "Elements": { | |
| "C": 10, | |
| "H": 18, | |
| "O": 1 | |
| }, | |
| "MODFACGroups": { | |
| "1": "3", | |
| "14": "1", | |
| "2": "3", | |
| "8": "2" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": { | |
| "1": "3", | |
| "15": "1", | |
| "2": "3", | |
| "8": "2" | |
| }, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false, | |
| "ChemSepFamily": 1000 | |
| } |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "Acentric_Factor": 0.9, | |
| "BO_BSW": 0.0, | |
| "BO_GOR": 0.0, | |
| "BO_OilVisc1": 0.0, | |
| "BO_OilVisc2": 0.0, | |
| "BO_OilViscTemp1": 0.0, | |
| "BO_OilViscTemp2": 0.0, | |
| "BO_PNA_A": 0.0, | |
| "BO_PNA_N": 0.0, | |
| "BO_PNA_P": 0.0, | |
| "BO_SGG": 0.0, | |
| "BO_SGO": 0.0, | |
| "CAS_Number": "16203-25-1", | |
| "Chao_Seader_Acentricity": 0.0, | |
| "Chao_Seader_Liquid_Molar_Volume": 0.0, | |
| "Chao_Seader_Solubility_Parameter": 0.0, | |
| "Charge": 0, | |
| "ChemicalStructure": "", | |
| "Comments": "", | |
| "CompCreatorStudyFile": "", | |
| "COSMODBName": null, | |
| "Critical_Compressibility": 0.25, | |
| "Critical_Pressure": 2450740.0, | |
| "Critical_Temperature": 921.86, | |
| "Critical_Volume": 0.734, | |
| "CurrentDB": "User", | |
| "Dipole_Moment": 0.0, | |
| "Electrolyte_Cp0": 0.0, | |
| "Electrolyte_DelGF": 0.0, | |
| "Electrolyte_DelHF": 0.0, | |
| "EnthalpyOfFusionAtTf": 18.89, | |
| "Formula": "C15H22O2", | |
| "HVap_A": 343.8422383919833, | |
| "HVap_B": 0.0, | |
| "HVap_C": 0.0, | |
| "HVap_D": 0.0, | |
| "HVap_E": 0.0, | |
| "HVap_TMAX": 0.0, | |
| "HVap_TMIN": 0.0, | |
| "HydrationNumber": 0.0, | |
| "ID": 19200, | |
| "Ideal_Gas_Heat_Capacity_Const_A": -224879.748848437, | |
| "Ideal_Gas_Heat_Capacity_Const_B": 2281.63873031985, | |
| "Ideal_Gas_Heat_Capacity_Const_C": -2.23369759698309, | |
| "Ideal_Gas_Heat_Capacity_Const_D": 0.000916657981734478, | |
| "Ideal_Gas_Heat_Capacity_Const_E": 6.34756637319836E-13, | |
| "IdealgasCpEquation": "5", | |
| "IG_Enthalpy_of_Formation_25C": -1440.788631, | |
| "IG_Entropy_of_Formation_25C": 0.0, | |
| "IG_Gibbs_Energy_of_Formation_25C": -23.85524687, | |
| "InChI": "InChI=1S/C15H22O2/c1-9-11-4-5-12(13(16)17)15(11)7-6-10(8-15)14(9,2)3/h10-12H,1,4-8H2,2-3H3,(H,16,17)", | |
| "Ion_CpAq_a": 0.0, | |
| "Ion_CpAq_b": 0.0, | |
| "Ion_CpAq_c": 0.0, | |
| "IsBlackOil": false, | |
| "IsCOOLPROPSupported": false, | |
| "IsFPROPSSupported": false, | |
| "IsHydratedSalt": false, | |
| "IsHYPO": 0, | |
| "IsIon": false, | |
| "IsModified": false, | |
| "IsPF": 0, | |
| "IsSalt": false, | |
| "Liquid_Density_Const_A": 0.0, | |
| "Liquid_Density_Const_B": 0.0, | |
| "Liquid_Density_Const_C": 0.0, | |
| "Liquid_Density_Const_D": 0.0, | |
| "Liquid_Density_Const_E": 0.0, | |
| "Liquid_Density_Tmax": 0.0, | |
| "Liquid_Density_Tmin": 0.0, | |
| "Liquid_Heat_Capacity_Const_A": 0.0, | |
| "Liquid_Heat_Capacity_Const_B": 0.0, | |
| "Liquid_Heat_Capacity_Const_C": 0.0, | |
| "Liquid_Heat_Capacity_Const_D": 0.0, | |
| "Liquid_Heat_Capacity_Const_E": 0.0, | |
| "Liquid_Heat_Capacity_Tmax": 0.0, | |
| "Liquid_Heat_Capacity_Tmin": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_A": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_B": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_C": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_D": 0.0, | |
| "Liquid_Thermal_Conductivity_Const_E": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmax": 0.0, | |
| "Liquid_Thermal_Conductivity_Tmin": 0.0, | |
| "Liquid_Viscosity_Const_A": 0.0, | |
| "Liquid_Viscosity_Const_B": 0.0, | |
| "Liquid_Viscosity_Const_C": 0.0, | |
| "Liquid_Viscosity_Const_D": 0.0, | |
| "Liquid_Viscosity_Const_E": 0.0, | |
| "LiquidDensityEquation": "0", | |
| "LiquidHeatCapacityEquation": "0", | |
| "LiquidThermalConductivityEquation": "0", | |
| "LiquidViscosityEquation": "0", | |
| "Molar_Weight": 234.334, | |
| "MolarVolume_k1i": 0.0, | |
| "MolarVolume_k2i": 0.0, | |
| "MolarVolume_k3i": 0.0, | |
| "MolarVolume_v2i": 0.0, | |
| "MolarVolume_v3i": 0.0, | |
| "Name": "Zizanoic acid", | |
| "NBP": null, | |
| "NegativeIon": "", | |
| "NegativeIonStoichCoeff": 0, | |
| "Normal_Boiling_Point": 707.71, | |
| "OriginalDB": "User", | |
| "PC_SAFT_epsilon_k": 0.0, | |
| "PC_SAFT_m": 0.0, | |
| "PC_SAFT_sigma": 0.0, | |
| "PF_MM": null, | |
| "PF_SG": null, | |
| "PF_Tv1": null, | |
| "PF_Tv2": null, | |
| "PF_v1": null, | |
| "PF_v2": null, | |
| "PF_vA": null, | |
| "PF_vB": null, | |
| "PF_Watson_K": null, | |
| "PositiveIon": "", | |
| "PositiveIonStoichCoeff": 0, | |
| "PR_Volume_Translation_Coefficient": 0.0, | |
| "SMILES": "C=C1C2CCC(C(=O)O)C23CCC(C3)C1(C)C", | |
| "Solid_Density_Const_A": 0.0, | |
| "Solid_Density_Const_B": 0.0, | |
| "Solid_Density_Const_C": 0.0, | |
| "Solid_Density_Const_D": 0.0, | |
| "Solid_Density_Const_E": 0.0, | |
| "Solid_Density_Tmax": 469.34, | |
| "Solid_Density_Tmin": 0.0, | |
| "Solid_Heat_Capacity_Const_A": 0.0, | |
| "Solid_Heat_Capacity_Const_B": 0.0, | |
| "Solid_Heat_Capacity_Const_C": 0.0, | |
| "Solid_Heat_Capacity_Const_D": 0.0, | |
| "Solid_Heat_Capacity_Const_E": 0.0, | |
| "Solid_Heat_Capacity_Tmax": 469.34, | |
| "Solid_Heat_Capacity_Tmin": 0.0, | |
| "SolidDensityAtTs": 0.0, | |
| "SolidDensityEquation": "0", | |
| "SolidHeatCapacityEquation": "0", | |
| "SolidTs": 0.0, | |
| "SRK_Volume_Translation_Coefficient": 0.0, | |
| "StandardStateMolarVolume": 0.0, | |
| "StoichSum": 0, | |
| "Surface_Tension_Const_A": 0.0, | |
| "Surface_Tension_Const_B": 0.0, | |
| "Surface_Tension_Const_C": 0.0, | |
| "Surface_Tension_Const_D": 0.0, | |
| "Surface_Tension_Const_E": 0.0, | |
| "Surface_Tension_Tmax": 0.0, | |
| "Surface_Tension_Tmin": 0.0, | |
| "SurfaceTensionEquation": "", | |
| "TemperatureOfFusion": 469.34, | |
| "UNIQUAC_Q": 0.0, | |
| "UNIQUAC_R": 0.0, | |
| "Vapor_Pressure_Constant_A": 0.0, | |
| "Vapor_Pressure_Constant_B": 0.0, | |
| "Vapor_Pressure_Constant_C": 0.0, | |
| "Vapor_Pressure_Constant_D": 0.0, | |
| "Vapor_Pressure_Constant_E": 0.0, | |
| "Vapor_Pressure_TMAX": 0.0, | |
| "Vapor_Pressure_TMIN": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_A": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_B": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_C": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_D": 0.0, | |
| "Vapor_Thermal_Conductivity_Const_E": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmax": 0.0, | |
| "Vapor_Thermal_Conductivity_Tmin": 0.0, | |
| "Vapor_Viscosity_Const_A": 0.0, | |
| "Vapor_Viscosity_Const_B": 0.0, | |
| "Vapor_Viscosity_Const_C": 0.0, | |
| "Vapor_Viscosity_Const_D": 0.0, | |
| "Vapor_Viscosity_Const_E": 0.0, | |
| "Vapor_Viscosity_Tmax": 0.0, | |
| "Vapor_Viscosity_Tmin": 0.0, | |
| "VaporizationEnthalpyEquation": "", | |
| "VaporPressureEquation": "0", | |
| "VaporThermalConductivityEquation": "", | |
| "VaporViscosityEquation": "", | |
| "Z_Rackett": 0.0, | |
| "Elements": {}, | |
| "MODFACGroups": { | |
| "1": "2", | |
| "42": "1", | |
| "7": "1", | |
| "78": "5", | |
| "79": "3", | |
| "80": "2" | |
| }, | |
| "NISTMODFACGroups": {}, | |
| "UNIFACGroups": {}, | |
| "FullerDiffusionVolume": 0.0, | |
| "LennardJonesDiameter": 0.0, | |
| "LennardJonesEnergy": 0.0, | |
| "Parachor": 0.0, | |
| "Tag": "", | |
| "ExtraProperties": {}, | |
| "COSTALD_SRK_Acentric_Factor": 0.0, | |
| "COSTALD_Characteristic_Volume": 0.0, | |
| "IsSolid": false | |
| } |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment