Created
February 9, 2022 10:48
-
-
Save cisert/d05664d4c98ac1cf86ee70b8700e56a9 to your computer and use it in GitHub Desktop.
Draw 3D molecule with highlighted atoms
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import py3Dmol | |
| from rdkit import Chem | |
| def draw_mol_with_highlights(mol, hit_ats, style=None): | |
| """Draw molecule in 3D with highlighted atoms. | |
| Parameters | |
| ---------- | |
| mol : RDKit molecule | |
| hit_ats : tuple of tuples | |
| atoms to highlight, from RDKit's GetSubstructMatches | |
| style : dict, optional | |
| drawing style, see https://3dmol.csb.pitt.edu/doc/$3Dmol.GLViewer.html for some examples | |
| Returns | |
| ------- | |
| py3Dmol viewer | |
| """ | |
| v = py3Dmol.view() | |
| if style is None: | |
| style = {'stick':{'colorscheme':'grayCarbon', "linewidth": 0.1}} | |
| v.addModel(Chem.MolToMolBlock(mol), "mol") | |
| v.setStyle({'model':0},style) | |
| hit_ats = [x for tup in hit_ats for x in tup] | |
| for atom in hit_ats: | |
| p = mol.GetConformer().GetAtomPosition(atom) | |
| v.addSphere({"center":{"x":p.x,"y":p.y,"z":p.z},"radius":0.9,"color":'green', "alpha": 0.8}) | |
| v.setBackgroundColor('white') | |
| v.zoomTo() | |
| return v | |
| #### Example, use in Jupyter notebook: | |
| # from rdkit.Chem import AllChem | |
| # cyclosporine_smiles = "CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C" | |
| # cyclosporine = Chem.AddHs(Chem.MolFromSmiles(cyclosporine_smiles)) | |
| # AllChem.EmbedMolecule(cyclosporine) | |
| # patt = Chem.MolFromSmarts('O[H]') | |
| # hit_ats = cyclosporine.GetSubstructMatches(patt) | |
| # draw_mol_with_highlights(cyclosporine, hit_ats) | |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment